C19H37NO4Si — CID 15838478
(4S)-3-[(2S)-6-[tert-butyl(dimethyl)silyl]oxy-2-methylhexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 15838478) has the molecular formula C19H37NO4Si and a molecular weight of 371.59 g/mol. Its IUPAC name is (4S)-3-[(2S)-6-[tert-butyl(dimethyl)silyl]oxy-2-methylhexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S)-6-[tert-butyl(dimethyl)silyl]oxy-2-methylhexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15838478 |
| Molecular Formula | C19H37NO4Si |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | (4S)-3-[(2S)-6-[tert-butyl(dimethyl)silyl]oxy-2-methylhexanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1COC(=O)N1C(=O)[C@@H](C)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H37NO4Si/c1-14(2)16-13-23-18(22)20(16)17(21)15(3)11-9-10-12-24-25(7,8)19(4,5)6/h14-16H,9-13H2,1-8H3/t15-,16+/m0/s1 |
| InChIKey | PXQAYUYKRCWQFY-JKSUJKDBSA-N |
| XLogP | 4.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|