C25H33IN6O2 — CID 110047789
2-[[[2-(4-methoxyphenyl)ethylamino]-[methyl-[(5-phenyl-1H-imidazol-2-yl)methyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110047789) has the molecular formula C25H33IN6O2 and a molecular weight of 576.48 g/mol. Its IUPAC name is 2-[[[2-(4-methoxyphenyl)ethylamino]-[methyl-[(5-phenyl-1H-imidazol-2-yl)methyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-(4-methoxyphenyl)ethylamino]-[methyl-[(5-phenyl-1H-imidazol-2-yl)methyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110047789 |
| Molecular Formula | C25H33IN6O2 |
| Molecular Weight | 576.48 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | 2-[[[2-(4-methoxyphenyl)ethylamino]-[methyl-[(5-phenyl-1H-imidazol-2-yl)methyl]amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(CCN/C(=N/CC(=O)N(C)C)N(C)Cc2ncc(-c3ccccc3)[nH]2)cc1.I |
| InChI | InChI=1S/C25H32N6O2.HI/c1-30(2)24(32)17-28-25(26-15-14-19-10-12-21(33-4)13-11-19)31(3)18-23-27-16-22(29-23)20-8-6-5-7-9-20;/h5-13,16H,14-15,17-18H2,1-4H3,(H,26,28)(H,27,29);1H |
| InChIKey | NBKVKNYQGJJATF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|