C18H22F3IN4OS — CID 110049737
N,N-dimethyl-2-[[[methyl-[(3,4,5-trifluorophenyl)methyl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110049737) has the molecular formula C18H22F3IN4OS and a molecular weight of 526.37 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[methyl-[(3,4,5-trifluorophenyl)methyl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[methyl-[(3,4,5-trifluorophenyl)methyl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110049737 |
| Molecular Formula | C18H22F3IN4OS |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | N,N-dimethyl-2-[[[methyl-[(3,4,5-trifluorophenyl)methyl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCc1cccs1)N(C)Cc1cc(F)c(F)c(F)c1.I |
| InChI | InChI=1S/C18H21F3N4OS.HI/c1-24(2)16(26)10-23-18(22-9-13-5-4-6-27-13)25(3)11-12-7-14(19)17(21)15(20)8-12;/h4-8H,9-11H2,1-3H3,(H,22,23);1H |
| InChIKey | MMMLKLAKHXDPFI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|