C17H25N5OS — CID 110047364
N,N-dimethyl-2-[[[methyl-[(1-methylpyrrol-2-yl)methyl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide (PubChem CID 110047364) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[methyl-[(1-methylpyrrol-2-yl)methyl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[methyl-[(1-methylpyrrol-2-yl)methyl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110047364 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N,N-dimethyl-2-[[[methyl-[(1-methylpyrrol-2-yl)methyl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]acetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCc1cccs1)N(C)Cc1cccn1C |
| InChI | InChI=1S/C17H25N5OS/c1-20(2)16(23)12-19-17(18-11-15-8-6-10-24-15)22(4)13-14-7-5-9-21(14)3/h5-10H,11-13H2,1-4H3,(H,18,19) |
| InChIKey | OSHYKBQEGSADAM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|