C16H27N5O — CID 110047354
N,N-dimethyl-2-[[[methyl-[(1-methylpyrrol-2-yl)methyl]amino]-(2-methylprop-2-enylamino)methylidene]amino]acetamide (PubChem CID 110047354) has the molecular formula C16H27N5O and a molecular weight of 305.43 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[methyl-[(1-methylpyrrol-2-yl)methyl]amino]-(2-methylprop-2-enylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[methyl-[(1-methylpyrrol-2-yl)methyl]amino]-(2-methylprop-2-enylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110047354 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | N,N-dimethyl-2-[[[methyl-[(1-methylpyrrol-2-yl)methyl]amino]-(2-methylprop-2-enylamino)methylidene]amino]acetamide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)N(C)Cc1cccn1C |
| InChI | InChI=1S/C16H27N5O/c1-13(2)10-17-16(18-11-15(22)19(3)4)21(6)12-14-8-7-9-20(14)5/h7-9H,1,10-12H2,2-6H3,(H,17,18) |
| InChIKey | XJOPWAHIZPGIQB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|