C13H26N4O — CID 110049814
N,N-dimethyl-2-[[[methyl(2-methylprop-2-enyl)amino]-(propylamino)methylidene]amino]acetamide (PubChem CID 110049814) has the molecular formula C13H26N4O and a molecular weight of 254.38 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[methyl(2-methylprop-2-enyl)amino]-(propylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[methyl(2-methylprop-2-enyl)amino]-(propylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110049814 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | N,N-dimethyl-2-[[[methyl(2-methylprop-2-enyl)amino]-(propylamino)methylidene]amino]acetamide |
| SMILES | C=C(C)CN(C)/C(=N\CC(=O)N(C)C)NCCC |
| InChI | InChI=1S/C13H26N4O/c1-7-8-14-13(17(6)10-11(2)3)15-9-12(18)16(4)5/h2,7-10H2,1,3-6H3,(H,14,15) |
| InChIKey | YNQJXKLWAHDVLH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|