C14H25IN4OS — CID 110038264
N,N-dimethyl-2-[[[methyl(thiophen-3-ylmethyl)amino]-(propylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110038264) has the molecular formula C14H25IN4OS and a molecular weight of 424.35 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[methyl(thiophen-3-ylmethyl)amino]-(propylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[methyl(thiophen-3-ylmethyl)amino]-(propylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110038264 |
| Molecular Formula | C14H25IN4OS |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N,N-dimethyl-2-[[[methyl(thiophen-3-ylmethyl)amino]-(propylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCCN/C(=N\CC(=O)N(C)C)N(C)Cc1ccsc1.I |
| InChI | InChI=1S/C14H24N4OS.HI/c1-5-7-15-14(16-9-13(19)17(2)3)18(4)10-12-6-8-20-11-12;/h6,8,11H,5,7,9-10H2,1-4H3,(H,15,16);1H |
| InChIKey | QIWPCXNXVKUXMJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|