C18H26N4O10 — CID 11004999
2,5-dimethoxy-1-N,4-N-bis(3-methoxypropyl)-3,6-dinitrobenzene-1,4-dicarboxamide (PubChem CID 11004999) has the molecular formula C18H26N4O10 and a molecular weight of 458.42 g/mol. Its IUPAC name is 2,5-dimethoxy-1-N,4-N-bis(3-methoxypropyl)-3,6-dinitrobenzene-1,4-dicarboxamide.
| Compound Name | 2,5-dimethoxy-1-N,4-N-bis(3-methoxypropyl)-3,6-dinitrobenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 11004999 |
| Molecular Formula | C18H26N4O10 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2,5-dimethoxy-1-N,4-N-bis(3-methoxypropyl)-3,6-dinitrobenzene-1,4-dicarboxamide |
| SMILES | COCCCNC(=O)c1c(OC)c([N+](=O)[O-])c(C(=O)NCCCOC)c(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H26N4O10/c1-29-9-5-7-19-17(23)11-13(21(25)26)16(32-4)12(14(22(27)28)15(11)31-3)18(24)20-8-6-10-30-2/h5-10H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | YFCWKXAHXNVDOJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 181.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|