tetradecanoic acid

C14H28O2 — CID 11005

IUPACtetradecanoic acid
SMILESCCCCCCCCCCCCCC(=O)O
InChIInChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)
InChIKeyTUNFSRHWOTWDNC-UHFFFAOYSA-N
MW228.38 g/mol
LogP4.77
Rot. Bonds12

About tetradecanoic acid

tetradecanoic acid (PubChem CID 11005) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is tetradecanoic acid.

Molecular Properties

Compound Nametetradecanoic acid
PubChem CID11005
Molecular FormulaC14H28O2
Molecular Weight228.38 g/mol
Exact Mass228.21
IUPAC Nametetradecanoic acid
SMILESCCCCCCCCCCCCCC(=O)O
InChIInChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)
InChIKeyTUNFSRHWOTWDNC-UHFFFAOYSA-N
XLogP4.77
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds12
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.38
LogP ≤ 54.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze tetradecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tetradecanoic acid?
The IUPAC name of tetradecanoic acid (CID 11005) is tetradecanoic acid.
What is the SMILES notation for tetradecanoic acid?
The canonical SMILES for tetradecanoic acid is CCCCCCCCCCCCCC(=O)O.
What is the InChIKey of tetradecanoic acid?
The InChIKey is TUNFSRHWOTWDNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16).
What are the key properties of tetradecanoic acid?
tetradecanoic acid has a molecular weight of 228.38 g/mol, XLogP of 4.77, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecanoic acid is sourced from PubChem (CID 11005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).