octadecanoic acid

C18H36O2 — CID 5281

💊View drug profile → stearic acid
IUPACoctadecanoic acid
SMILESCCCCCCCCCCCCCCCCCC(=O)O
InChIInChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)
InChIKeyQIQXTHQIDYTFRH-UHFFFAOYSA-N
MW284.48 g/mol
LogP6.33
Rot. Bonds16

About octadecanoic acid

octadecanoic acid (PubChem CID 5281) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is octadecanoic acid.

Molecular Properties

Compound Nameoctadecanoic acid
PubChem CID5281
Molecular FormulaC18H36O2
Molecular Weight284.48 g/mol
Exact Mass284.27
IUPAC Nameoctadecanoic acid
SMILESCCCCCCCCCCCCCCCCCC(=O)O
InChIInChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20)
InChIKeyQIQXTHQIDYTFRH-UHFFFAOYSA-N
XLogP6.33
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds16
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500284.48
LogP ≤ 56.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze octadecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of octadecanoic acid?
The IUPAC name of octadecanoic acid (CID 5281) is octadecanoic acid.
What is the SMILES notation for octadecanoic acid?
The canonical SMILES for octadecanoic acid is CCCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of octadecanoic acid?
The InChIKey is QIQXTHQIDYTFRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20).
What are the key properties of octadecanoic acid?
octadecanoic acid has a molecular weight of 284.48 g/mol, XLogP of 6.33, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanoic acid is sourced from PubChem (CID 5281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).