C17H25N5O — CID 110050496
1-[(1-cyclopentylpyrazol-3-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine (PubChem CID 110050496) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-[(1-cyclopentylpyrazol-3-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(1-cyclopentylpyrazol-3-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110050496 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 1-[(1-cyclopentylpyrazol-3-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccco1)NCc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C17H25N5O/c1-18-17(19-10-8-16-7-4-12-23-16)20-13-14-9-11-22(21-14)15-5-2-3-6-15/h4,7,9,11-12,15H,2-3,5-6,8,10,13H2,1H3,(H2,18,19,20) |
| InChIKey | VBBRAOMDIAVGRQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|