C16H22FN3OS — CID 110051204
2-(3-fluoropropyl)-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 110051204) has the molecular formula C16H22FN3OS and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-(3-fluoropropyl)-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-(3-fluoropropyl)-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 110051204 |
| Molecular Formula | C16H22FN3OS |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-(3-fluoropropyl)-1-[2-(furan-2-yl)ethyl]-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | FCCC/N=C(\NCCc1ccco1)NCCc1cccs1 |
| InChI | InChI=1S/C16H22FN3OS/c17-8-3-9-18-16(19-10-6-14-4-1-12-21-14)20-11-7-15-5-2-13-22-15/h1-2,4-5,12-13H,3,6-11H2,(H2,18,19,20) |
| InChIKey | FXTWBPNBICCANL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|