C24H32F3NO3Si — CID 11005148
2,2,2-trifluoroethyl N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate (PubChem CID 11005148) has the molecular formula C24H32F3NO3Si and a molecular weight of 467.60 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 11005148 |
| Molecular Formula | C24H32F3NO3Si |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)N(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C24H32F3NO3Si/c1-19(2)28(22(29)30-18-24(25,26)27)16-17-31-32(23(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,19H,16-18H2,1-5H3 |
| InChIKey | GIZIXSNIXAFJLV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|