C23H34N4O4 — CID 110052690
2-[[[[3-(3,4-dimethoxyphenyl)-2-methylpropyl]amino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110052690) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-[[[[3-(3,4-dimethoxyphenyl)-2-methylpropyl]amino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[3-(3,4-dimethoxyphenyl)-2-methylpropyl]amino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110052690 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 2-[[[[3-(3,4-dimethoxyphenyl)-2-methylpropyl]amino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COc1ccc(CC(C)CN/C(=N/CC(=O)N(C)C)NCCc2ccco2)cc1OC |
| InChI | InChI=1S/C23H34N4O4/c1-17(13-18-8-9-20(29-4)21(14-18)30-5)15-25-23(26-16-22(28)27(2)3)24-11-10-19-7-6-12-31-19/h6-9,12,14,17H,10-11,13,15-16H2,1-5H3,(H2,24,25,26) |
| InChIKey | DSQMZDOMPXZMID-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|