C25H38IN5O — CID 110054457
2-(cyclohexylmethyl)-1-[2-(furan-2-yl)ethyl]-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine;hydroiodide (PubChem CID 110054457) has the molecular formula C25H38IN5O and a molecular weight of 551.52 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-1-[2-(furan-2-yl)ethyl]-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine;hydroiodide.
| Compound Name | 2-(cyclohexylmethyl)-1-[2-(furan-2-yl)ethyl]-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110054457 |
| Molecular Formula | C25H38IN5O |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 2-(cyclohexylmethyl)-1-[2-(furan-2-yl)ethyl]-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]guanidine;hydroiodide |
| SMILES | I.c1ccc(CN2CCC(N/C(=N/CC3CCCCC3)NCCc3ccco3)CC2)nc1 |
| InChI | InChI=1S/C25H37N5O.HI/c1-2-7-21(8-3-1)19-28-25(27-15-11-24-10-6-18-31-24)29-22-12-16-30(17-13-22)20-23-9-4-5-14-26-23;/h4-6,9-10,14,18,21-22H,1-3,7-8,11-13,15-17,19-20H2,(H2,27,28,29);1H |
| InChIKey | JNPKADPRGRXHPS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|