C25H39IN4O2 — CID 110054479
2-(3-ethoxypropyl)-1-[2-(furan-2-yl)ethyl]-3-[1-[(2-methylphenyl)methyl]piperidin-4-yl]guanidine;hydroiodide (PubChem CID 110054479) has the molecular formula C25H39IN4O2 and a molecular weight of 554.52 g/mol. Its IUPAC name is 2-(3-ethoxypropyl)-1-[2-(furan-2-yl)ethyl]-3-[1-[(2-methylphenyl)methyl]piperidin-4-yl]guanidine;hydroiodide.
| Compound Name | 2-(3-ethoxypropyl)-1-[2-(furan-2-yl)ethyl]-3-[1-[(2-methylphenyl)methyl]piperidin-4-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110054479 |
| Molecular Formula | C25H39IN4O2 |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 2-(3-ethoxypropyl)-1-[2-(furan-2-yl)ethyl]-3-[1-[(2-methylphenyl)methyl]piperidin-4-yl]guanidine;hydroiodide |
| SMILES | CCOCCC/N=C(\NCCc1ccco1)NC1CCN(Cc2ccccc2C)CC1.I |
| InChI | InChI=1S/C25H38N4O2.HI/c1-3-30-18-7-14-26-25(27-15-11-24-10-6-19-31-24)28-23-12-16-29(17-13-23)20-22-9-5-4-8-21(22)2;/h4-6,8-10,19,23H,3,7,11-18,20H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | AYHCKTKLDFEMAO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|