C21H35N3O4 — CID 110054966
ethyl 4-[[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]cyclohexane-1-carboxylate (PubChem CID 110054966) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is ethyl 4-[[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 110054966 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | ethyl 4-[[N'-(3-ethoxypropyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOCCC/N=C(\NCCc1ccco1)NC1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C21H35N3O4/c1-3-26-15-6-13-22-21(23-14-12-19-7-5-16-28-19)24-18-10-8-17(9-11-18)20(25)27-4-2/h5,7,16-18H,3-4,6,8-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | QXQFHYYAUVHWMY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|