C26H38N4O2 — CID 110055516
2-[2-(furan-2-yl)ethyl]-1-[1-(3-methoxypropyl)piperidin-4-yl]-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine (PubChem CID 110055516) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)ethyl]-1-[1-(3-methoxypropyl)piperidin-4-yl]-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine.
| Compound Name | 2-[2-(furan-2-yl)ethyl]-1-[1-(3-methoxypropyl)piperidin-4-yl]-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine |
|---|---|
| PubChem CID | 110055516 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 2-[2-(furan-2-yl)ethyl]-1-[1-(3-methoxypropyl)piperidin-4-yl]-3-(1,2,3,4-tetrahydronaphthalen-2-yl)guanidine |
| SMILES | COCCCN1CCC(N/C(=N\CCc2ccco2)NC2CCc3ccccc3C2)CC1 |
| InChI | InChI=1S/C26H38N4O2/c1-31-18-5-15-30-16-12-23(13-17-30)28-26(27-14-11-25-8-4-19-32-25)29-24-10-9-21-6-2-3-7-22(21)20-24/h2-4,6-8,19,23-24H,5,9-18,20H2,1H3,(H2,27,28,29) |
| InChIKey | YYARTHPHNFZJDD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|