C25H36N4O2 — CID 110055312
1-(1-butylpiperidin-4-yl)-3-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]guanidine (PubChem CID 110055312) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-(1-butylpiperidin-4-yl)-3-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]guanidine.
| Compound Name | 1-(1-butylpiperidin-4-yl)-3-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110055312 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 1-(1-butylpiperidin-4-yl)-3-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]guanidine |
| SMILES | CCCCN1CCC(N/C(=N\CCc2ccco2)NC2CCOc3ccccc32)CC1 |
| InChI | InChI=1S/C25H36N4O2/c1-2-3-15-29-16-11-20(12-17-29)27-25(26-14-10-21-7-6-18-30-21)28-23-13-19-31-24-9-5-4-8-22(23)24/h4-9,18,20,23H,2-3,10-17,19H2,1H3,(H2,26,27,28) |
| InChIKey | RMOKGFCSADDBPI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|