C27H32N4O2 — CID 110055180
1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-phenylpiperidin-4-yl)guanidine (PubChem CID 110055180) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-phenylpiperidin-4-yl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-phenylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 110055180 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-phenylpiperidin-4-yl)guanidine |
| SMILES | c1ccc(N2CCC(N/C(=N\CCc3ccco3)NC3CCOc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C27H32N4O2/c1-2-7-22(8-3-1)31-17-13-21(14-18-31)29-27(28-16-12-23-9-6-19-32-23)30-25-15-20-33-26-11-5-4-10-24(25)26/h1-11,19,21,25H,12-18,20H2,(H2,28,29,30) |
| InChIKey | OHHMSGSILQMVHT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|