C25H30N6O2 — CID 110054316
1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)guanidine (PubChem CID 110054316) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 110054316 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(1-pyrimidin-2-ylpiperidin-4-yl)guanidine |
| SMILES | c1cnc(N2CCC(N/C(=N\CCc3ccco3)NC3CCOc4ccccc43)CC2)nc1 |
| InChI | InChI=1S/C25H30N6O2/c1-2-7-23-21(6-1)22(11-18-33-23)30-24(26-14-8-20-5-3-17-32-20)29-19-9-15-31(16-10-19)25-27-12-4-13-28-25/h1-7,12-13,17,19,22H,8-11,14-16,18H2,(H2,26,29,30) |
| InChIKey | PTAFYPZQMHYSCH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|