C22H30IN3O2S — CID 110053953
1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 110053953) has the molecular formula C22H30IN3O2S and a molecular weight of 527.47 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110053953 |
| Molecular Formula | C22H30IN3O2S |
| Molecular Weight | 527.47 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(furan-2-yl)ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | CSC1CCC(N/C(=N\CCc2ccco2)NC2CCOc3ccccc32)C1.I |
| InChI | InChI=1S/C22H29N3O2S.HI/c1-28-18-9-8-16(15-18)24-22(23-12-10-17-5-4-13-26-17)25-20-11-14-27-21-7-3-2-6-19(20)21;/h2-7,13,16,18,20H,8-12,14-15H2,1H3,(H2,23,24,25);1H |
| InChIKey | WVPZUXQHWVJCPB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|