C22H33NO12 — CID 11005640
(2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-[4-(4-nitrophenyl)butoxy]oxan-4-yl]oxy-6-methyloxane-3,4,5-triol (PubChem CID 11005640) has the molecular formula C22H33NO12 and a molecular weight of 503.50 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-[4-(4-nitrophenyl)butoxy]oxan-4-yl]oxy-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-[4-(4-nitrophenyl)butoxy]oxan-4-yl]oxy-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 11005640 |
| Molecular Formula | C22H33NO12 |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-3,5-dihydroxy-2-(hydroxymethyl)-6-[4-(4-nitrophenyl)butoxy]oxan-4-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](OCCCCc3ccc([N+](=O)[O-])cc3)[C@@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H33NO12/c1-11-15(25)17(27)18(28)22(33-11)35-20-16(26)14(10-24)34-21(19(20)29)32-9-3-2-4-12-5-7-13(8-6-12)23(30)31/h5-8,11,14-22,24-29H,2-4,9-10H2,1H3/t11-,14+,15-,16-,17+,18+,19+,20-,21+,22-/m0/s1 |
| InChIKey | GFCMLUJVHZKTGT-VZWSXCNISA-N |
| XLogP | -1.41 |
| TPSA | 201.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|