C22H32N4O4S — CID 110056916
ethyl 4-[[N-[2-(furan-2-yl)ethyl]-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 110056916) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is ethyl 4-[[N-[2-(furan-2-yl)ethyl]-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-[2-(furan-2-yl)ethyl]-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110056916 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | ethyl 4-[[N-[2-(furan-2-yl)ethyl]-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/CC(C)(O)c2cccs2)NCCc2ccco2)CC1 |
| InChI | InChI=1S/C22H32N4O4S/c1-3-29-21(27)26-12-9-17(10-13-26)25-20(23-11-8-18-6-4-14-30-18)24-16-22(2,28)19-7-5-15-31-19/h4-7,14-15,17,28H,3,8-13,16H2,1-2H3,(H2,23,24,25) |
| InChIKey | BWHDRWRALKODAO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|