C23H31IN4O5 — CID 111862391
ethyl 4-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111862391) has the molecular formula C23H31IN4O5 and a molecular weight of 570.43 g/mol. Its IUPAC name is ethyl 4-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111862391 |
| Molecular Formula | C23H31IN4O5 |
| Molecular Weight | 570.43 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | ethyl 4-[[N'-(1,3-benzodioxol-5-ylmethyl)-N-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/Cc2ccc3c(c2)OCO3)NCCc2ccco2)CC1.I |
| InChI | InChI=1S/C23H30N4O5.HI/c1-2-29-23(28)27-11-8-18(9-12-27)26-22(24-10-7-19-4-3-13-30-19)25-15-17-5-6-20-21(14-17)32-16-31-20;/h3-6,13-14,18H,2,7-12,15-16H2,1H3,(H2,24,25,26);1H |
| InChIKey | DNCKUKMXLRRFHX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|