C22H26FN5OS — CID 110058694
1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine (PubChem CID 110058694) has the molecular formula C22H26FN5OS and a molecular weight of 427.55 g/mol. Its IUPAC name is 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 110058694 |
| Molecular Formula | C22H26FN5OS |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1-[1-(3-fluoro-2-pyridinyl)pyrrolidin-3-yl]-3-[2-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylethyl)guanidine |
| SMILES | Fc1cccnc1N1CCC(N/C(=N/CCc2cccs2)NCCc2ccco2)C1 |
| InChI | InChI=1S/C22H26FN5OS/c23-20-6-1-10-24-21(20)28-13-9-17(16-28)27-22(25-11-7-18-4-2-14-29-18)26-12-8-19-5-3-15-30-19/h1-6,10,14-15,17H,7-9,11-13,16H2,(H2,25,26,27) |
| InChIKey | FANQWYKWGZBMAC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|