C22H30F2IN3O4 — CID 110058857
2-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110058857) has the molecular formula C22H30F2IN3O4 and a molecular weight of 565.40 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110058857 |
| Molecular Formula | C22H30F2IN3O4 |
| Molecular Weight | 565.40 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 2-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCOc1cccc(C/N=C(\NCCc2ccco2)NCC2CCCO2)c1OC(F)F.I |
| InChI | InChI=1S/C22H29F2N3O4.HI/c1-2-28-19-9-3-6-16(20(19)31-21(23)24)14-26-22(27-15-18-8-5-13-30-18)25-11-10-17-7-4-12-29-17;/h3-4,6-7,9,12,18,21H,2,5,8,10-11,13-15H2,1H3,(H2,25,26,27);1H |
| InChIKey | VRLROJXVMTXMQC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|