C24H36N4O2 — CID 110059964
1-(2-bicyclo[2.2.1]heptanyl)-3-[1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-2-[2-(furan-2-yl)ethyl]guanidine (PubChem CID 110059964) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-3-[1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-2-[2-(furan-2-yl)ethyl]guanidine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-[1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-2-[2-(furan-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110059964 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-3-[1-(cyclopentanecarbonyl)pyrrolidin-3-yl]-2-[2-(furan-2-yl)ethyl]guanidine |
| SMILES | O=C(C1CCCC1)N1CCC(N/C(=N\CCc2ccco2)NC2CC3CCC2C3)C1 |
| InChI | InChI=1S/C24H36N4O2/c29-23(18-4-1-2-5-18)28-12-10-20(16-28)26-24(25-11-9-21-6-3-13-30-21)27-22-15-17-7-8-19(22)14-17/h3,6,13,17-20,22H,1-2,4-5,7-12,14-16H2,(H2,25,26,27) |
| InChIKey | BAMIYFUHYPTEPP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|