C22H33N3O2S — CID 110060520
1-(2-bicyclo[2.2.1]heptanyl)-2-[2-(furan-2-yl)ethyl]-3-(6-oxa-2-thiaspiro[4.5]decan-9-yl)guanidine (PubChem CID 110060520) has the molecular formula C22H33N3O2S and a molecular weight of 403.59 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-2-[2-(furan-2-yl)ethyl]-3-(6-oxa-2-thiaspiro[4.5]decan-9-yl)guanidine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-[2-(furan-2-yl)ethyl]-3-(6-oxa-2-thiaspiro[4.5]decan-9-yl)guanidine |
|---|---|
| PubChem CID | 110060520 |
| Molecular Formula | C22H33N3O2S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-[2-(furan-2-yl)ethyl]-3-(6-oxa-2-thiaspiro[4.5]decan-9-yl)guanidine |
| SMILES | c1coc(CC/N=C(/NC2CCOC3(CCSC3)C2)NC2CC3CCC2C3)c1 |
| InChI | InChI=1S/C22H33N3O2S/c1-2-19(26-9-1)5-8-23-21(25-20-13-16-3-4-17(20)12-16)24-18-6-10-27-22(14-18)7-11-28-15-22/h1-2,9,16-18,20H,3-8,10-15H2,(H2,23,24,25) |
| InChIKey | UIXAOYIFTQRTDN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|