C36H44N2O3 — CID 11006167
[(1R,2R,3S)-3-(dibenzylamino)-2-[(E)-3-phenylprop-1-enyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11006167) has the molecular formula C36H44N2O3 and a molecular weight of 552.76 g/mol. Its IUPAC name is [(1R,2R,3S)-3-(dibenzylamino)-2-[(E)-3-phenylprop-1-enyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(1R,2R,3S)-3-(dibenzylamino)-2-[(E)-3-phenylprop-1-enyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11006167 |
| Molecular Formula | C36H44N2O3 |
| Molecular Weight | 552.76 g/mol |
| Exact Mass | 552.34 |
| IUPAC Name | [(1R,2R,3S)-3-(dibenzylamino)-2-[(E)-3-phenylprop-1-enyl]cyclopentyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)COC(C)(C)N1C(=O)O[C@@H]1CC[C@H](N(Cc2ccccc2)Cc2ccccc2)[C@H]1/C=C/Cc1ccccc1 |
| InChI | InChI=1S/C36H44N2O3/c1-35(2)27-40-36(3,4)38(35)34(39)41-33-24-23-32(31(33)22-14-21-28-15-8-5-9-16-28)37(25-29-17-10-6-11-18-29)26-30-19-12-7-13-20-30/h5-20,22,31-33H,21,23-27H2,1-4H3/b22-14+/t31-,32+,33-/m1/s1 |
| InChIKey | NQNQCHKMWPKSGF-MQEUCWLYSA-N |
| XLogP | 7.62 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.76 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|