C30H34ClN3O4 — CID 110063034
(3R)-1'-[5-(2-chlorophenyl)-1,2-oxazole-3-carbonyl]-3,5-dimethylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one (PubChem CID 110063034) has the molecular formula C30H34ClN3O4 and a molecular weight of 536.07 g/mol. Its IUPAC name is (3R)-1'-[5-(2-chlorophenyl)-1,2-oxazole-3-carbonyl]-3,5-dimethylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one.
| Compound Name | (3R)-1'-[5-(2-chlorophenyl)-1,2-oxazole-3-carbonyl]-3,5-dimethylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 110063034 |
| Molecular Formula | C30H34ClN3O4 |
| Molecular Weight | 536.07 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (3R)-1'-[5-(2-chlorophenyl)-1,2-oxazole-3-carbonyl]-3,5-dimethylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one |
| SMILES | C[C@H]1Oc2ccccc2CCCCC2(CCN(C(=O)c3cc(-c4ccccc4Cl)on3)CC2)CN(C)C1=O |
| InChI | InChI=1S/C30H34ClN3O4/c1-21-28(35)33(2)20-30(14-8-7-10-22-9-3-6-13-26(22)37-21)15-17-34(18-16-30)29(36)25-19-27(38-32-25)23-11-4-5-12-24(23)31/h3-6,9,11-13,19,21H,7-8,10,14-18,20H2,1-2H3/t21-/m1/s1 |
| InChIKey | DPWZAAKOWFLUGA-OAQYLSRUSA-N |
| XLogP | 5.87 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.07 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |