C29H41N5O3 — CID 133071408
(3R)-1'-[3-[(4,6-dimethylpyrimidin-2-yl)amino]propanoyl]-3,5-dimethylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one (PubChem CID 133071408) has the molecular formula C29H41N5O3 and a molecular weight of 507.68 g/mol. Its IUPAC name is (3R)-1'-[3-[(4,6-dimethylpyrimidin-2-yl)amino]propanoyl]-3,5-dimethylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one.
| Compound Name | (3R)-1'-[3-[(4,6-dimethylpyrimidin-2-yl)amino]propanoyl]-3,5-dimethylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 133071408 |
| Molecular Formula | C29H41N5O3 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | (3R)-1'-[3-[(4,6-dimethylpyrimidin-2-yl)amino]propanoyl]-3,5-dimethylspiro[2-oxa-5-azabicyclo[10.4.0]hexadeca-1(16),12,14-triene-7,4'-piperidine]-4-one |
| SMILES | Cc1cc(C)nc(NCCC(=O)N2CCC3(CCCCc4ccccc4O[C@H](C)C(=O)N(C)C3)CC2)n1 |
| InChI | InChI=1S/C29H41N5O3/c1-21-19-22(2)32-28(31-21)30-16-12-26(35)34-17-14-29(15-18-34)13-8-7-10-24-9-5-6-11-25(24)37-23(3)27(36)33(4)20-29/h5-6,9,11,19,23H,7-8,10,12-18,20H2,1-4H3,(H,30,31,32)/t23-/m1/s1 |
| InChIKey | MLCHIPSFRSZCIW-HSZRJFAPSA-N |
| XLogP | 4.16 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |