C30H39N5O3 — CID 110065044
1-[9-[(3,4-dimethoxyphenyl)methyl]-6-pyrimidin-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-2-yl]-3-methylbutan-1-one (PubChem CID 110065044) has the molecular formula C30H39N5O3 and a molecular weight of 517.67 g/mol. Its IUPAC name is 1-[9-[(3,4-dimethoxyphenyl)methyl]-6-pyrimidin-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-2-yl]-3-methylbutan-1-one.
| Compound Name | 1-[9-[(3,4-dimethoxyphenyl)methyl]-6-pyrimidin-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-2-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 110065044 |
| Molecular Formula | C30H39N5O3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | 1-[9-[(3,4-dimethoxyphenyl)methyl]-6-pyrimidin-2-yl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-2-yl]-3-methylbutan-1-one |
| SMILES | COc1ccc(CN2CCN(c3ncccn3)CCCN(C(=O)CC(C)C)c3ccccc3C2)cc1OC |
| InChI | InChI=1S/C30H39N5O3/c1-23(2)19-29(36)35-16-8-15-34(30-31-13-7-14-32-30)18-17-33(22-25-9-5-6-10-26(25)35)21-24-11-12-27(37-3)28(20-24)38-4/h5-7,9-14,20,23H,8,15-19,21-22H2,1-4H3 |
| InChIKey | JDTGBXJVWCWAOF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |