C32H40N6O3 — CID 110066197
1'-[(5-methoxy-1-propan-2-ylindol-3-yl)methyl]spiro[3-oxa-11,17,18,19-tetrazatricyclo[15.2.1.04,9]icosa-1(20),4,6,8,18-pentaene-13,4'-piperidine]-12-one (PubChem CID 110066197) has the molecular formula C32H40N6O3 and a molecular weight of 556.71 g/mol. Its IUPAC name is 1'-[(5-methoxy-1-propan-2-ylindol-3-yl)methyl]spiro[3-oxa-11,17,18,19-tetrazatricyclo[15.2.1.04,9]icosa-1(20),4,6,8,18-pentaene-13,4'-piperidine]-12-one.
| Compound Name | 1'-[(5-methoxy-1-propan-2-ylindol-3-yl)methyl]spiro[3-oxa-11,17,18,19-tetrazatricyclo[15.2.1.04,9]icosa-1(20),4,6,8,18-pentaene-13,4'-piperidine]-12-one |
|---|---|
| PubChem CID | 110066197 |
| Molecular Formula | C32H40N6O3 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | 1'-[(5-methoxy-1-propan-2-ylindol-3-yl)methyl]spiro[3-oxa-11,17,18,19-tetrazatricyclo[15.2.1.04,9]icosa-1(20),4,6,8,18-pentaene-13,4'-piperidine]-12-one |
| SMILES | COc1ccc2c(c1)c(CN1CCC3(CCCn4cc(nn4)COc4ccccc4CNC3=O)CC1)cn2C(C)C |
| InChI | InChI=1S/C32H40N6O3/c1-23(2)38-20-25(28-17-27(40-3)9-10-29(28)38)19-36-15-12-32(13-16-36)11-6-14-37-21-26(34-35-37)22-41-30-8-5-4-7-24(30)18-33-31(32)39/h4-5,7-10,17,20-21,23H,6,11-16,18-19,22H2,1-3H3,(H,33,39) |
| InChIKey | BRRUSHCTRPTHLS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |