C24H26N4O2 — CID 110067303
N-(pyridin-3-ylmethyl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaen-9-amine (PubChem CID 110067303) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaen-9-amine.
| Compound Name | N-(pyridin-3-ylmethyl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaen-9-amine |
|---|---|
| PubChem CID | 110067303 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-2,17-dioxa-4,10-diazatricyclo[16.4.0.03,8]docosa-1(22),3(8),4,6,9,18,20-heptaen-9-amine |
| SMILES | c1cncc(CN/C2=N\CCCCCCOc3ccccc3Oc3ncccc32)c1 |
| InChI | InChI=1S/C24H26N4O2/c1-2-6-16-29-21-11-3-4-12-22(21)30-24-20(10-8-15-27-24)23(26-14-5-1)28-18-19-9-7-13-25-17-19/h3-4,7-13,15,17H,1-2,5-6,14,16,18H2,(H,26,28) |
| InChIKey | ITGYBCGXMJGBJR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |