C28H44O15S — CID 11006811
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-ethylsulfanyl-1-hydroxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]hexan-2-yl] acetate (PubChem CID 11006811) has the molecular formula C28H44O15S and a molecular weight of 652.71 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-ethylsulfanyl-1-hydroxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]hexan-2-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-ethylsulfanyl-1-hydroxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]hexan-2-yl] acetate |
|---|---|
| PubChem CID | 11006811 |
| Molecular Formula | C28H44O15S |
| Molecular Weight | 652.71 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-ethylsulfanyl-1-hydroxy-6-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]hexan-2-yl] acetate |
| SMILES | CCS[C@H](OC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](CO)OC(C)=O |
| InChI | InChI=1S/C28H44O15S/c1-10-44-26(34-12-18-20-22(41-27(6,7)40-20)23-25(39-18)43-28(8,9)42-23)24(38-16(5)33)21(37-15(4)32)19(36-14(3)31)17(11-29)35-13(2)30/h17-26,29H,10-12H2,1-9H3/t17-,18-,19+,20+,21+,22+,23-,24-,25-,26+/m1/s1 |
| InChIKey | RCYHPLMOHHHPDU-SRGRUXLRSA-N |
| XLogP | 1.20 |
| TPSA | 180.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.71 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|