C24H36O14S — CID 91377899
[(2R,3R,4S,5R,6S)-6-[(2S)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyethyl]sulfanyl-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 91377899) has the molecular formula C24H36O14S and a molecular weight of 580.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-[(2S)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyethyl]sulfanyl-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-[(2S)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyethyl]sulfanyl-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91377899 |
| Molecular Formula | C24H36O14S |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-[(2S)-2-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-hydroxyethyl]sulfanyl-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@H]([C@H](O)CS[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C24H36O14S/c1-10(25)31-8-15-17(32-11(2)26)18(33-12(3)27)21(34-13(4)28)23(35-15)39-9-14(29)16-19-20(22(30-7)36-16)38-24(5,6)37-19/h14-23,29H,8-9H2,1-7H3/t14-,15-,16-,17-,18+,19+,20+,21-,22+,23+/m1/s1 |
| InChIKey | LWPGCLWYLCOZGI-YWXBECCESA-N |
| XLogP | 0.05 |
| TPSA | 171.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|