C13H19FO7S — CID 91455715
[(2R)-2-[(3aR,5S,6S,6aS)-6-fluoro-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-acetylsulfanylethyl] acetate (PubChem CID 91455715) has the molecular formula C13H19FO7S and a molecular weight of 338.35 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5S,6S,6aS)-6-fluoro-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-acetylsulfanylethyl] acetate.
| Compound Name | [(2R)-2-[(3aR,5S,6S,6aS)-6-fluoro-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-acetylsulfanylethyl] acetate |
|---|---|
| PubChem CID | 91455715 |
| Molecular Formula | C13H19FO7S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | [(2R)-2-[(3aR,5S,6S,6aS)-6-fluoro-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-2-acetylsulfanylethyl] acetate |
| SMILES | CC(=O)OC[C@@H](SC(C)=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@]1(O)F |
| InChI | InChI=1S/C13H19FO7S/c1-6(15)18-5-8(22-7(2)16)9-13(14,17)10-11(19-9)21-12(3,4)20-10/h8-11,17H,5H2,1-4H3/t8-,9-,10+,11-,13+/m1/s1 |
| InChIKey | MCARHGDNADQQFN-HMUNZLOLSA-N |
| XLogP | 0.73 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|