C13H19FO6S — CID 11034616
[(2R)-2-[(3aR,5S,6R,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetylsulfanylethyl] acetate (PubChem CID 11034616) has the molecular formula C13H19FO6S and a molecular weight of 322.35 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5S,6R,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetylsulfanylethyl] acetate.
| Compound Name | [(2R)-2-[(3aR,5S,6R,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetylsulfanylethyl] acetate |
|---|---|
| PubChem CID | 11034616 |
| Molecular Formula | C13H19FO6S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [(2R)-2-[(3aR,5S,6R,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-acetylsulfanylethyl] acetate |
| SMILES | CC(=O)OC[C@@H](SC(C)=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1F |
| InChI | InChI=1S/C13H19FO6S/c1-6(15)17-5-8(21-7(2)16)10-9(14)11-12(18-10)20-13(3,4)19-11/h8-12H,5H2,1-4H3/t8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | FQMZCQWCQKTZBR-IYKVGLELSA-N |
| XLogP | 1.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|