C10H17FO3S — CID 145161649
(3aR,5R,6aS)-6-fluoro-2,2-dimethyl-5-(2-methylsulfanylethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 145161649) has the molecular formula C10H17FO3S and a molecular weight of 236.31 g/mol. Its IUPAC name is (3aR,5R,6aS)-6-fluoro-2,2-dimethyl-5-(2-methylsulfanylethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6aS)-6-fluoro-2,2-dimethyl-5-(2-methylsulfanylethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 145161649 |
| Molecular Formula | C10H17FO3S |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (3aR,5R,6aS)-6-fluoro-2,2-dimethyl-5-(2-methylsulfanylethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CSCC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2C1F |
| InChI | InChI=1S/C10H17FO3S/c1-10(2)13-8-7(11)6(4-5-15-3)12-9(8)14-10/h6-9H,4-5H2,1-3H3/t6-,7?,8-,9-/m1/s1 |
| InChIKey | IWRGOJJHWNVYOA-CWWFFFCGSA-N |
| XLogP | 1.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |