C10H15F3O4S — CID 100968137
(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 100968137) has the molecular formula C10H15F3O4S and a molecular weight of 288.29 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 100968137 |
| Molecular Formula | C10H15F3O4S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-6-(trifluoromethylsulfanylmethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CO[C@@H]1O[C@H](CSC(F)(F)F)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C10H15F3O4S/c1-9(2)16-6-5(4-18-10(11,12)13)15-8(14-3)7(6)17-9/h5-8H,4H2,1-3H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | KSRUYEMQZYIODC-WCTZXXKLSA-N |
| XLogP | 2.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |