C14H22O6S — CID 6420437
S-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] ethanethioate (PubChem CID 6420437) has the molecular formula C14H22O6S and a molecular weight of 318.39 g/mol. Its IUPAC name is S-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] ethanethioate.
| Compound Name | S-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] ethanethioate |
|---|---|
| PubChem CID | 6420437 |
| Molecular Formula | C14H22O6S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | S-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] ethanethioate |
| SMILES | CC(=O)SC1C(C2COC(C)(C)O2)OC2OC(C)(C)OC21 |
| InChI | InChI=1S/C14H22O6S/c1-7(15)21-11-9(8-6-16-13(2,3)18-8)17-12-10(11)19-14(4,5)20-12/h8-12H,6H2,1-5H3 |
| InChIKey | ZBBVHGNVUXSQAK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|