C10H15FO5S — CID 91539475
S-[[(5S,6S,6aS)-6-fluoro-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl] ethanethioate (PubChem CID 91539475) has the molecular formula C10H15FO5S and a molecular weight of 266.29 g/mol. Its IUPAC name is S-[[(5S,6S,6aS)-6-fluoro-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl] ethanethioate.
| Compound Name | S-[[(5S,6S,6aS)-6-fluoro-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 91539475 |
| Molecular Formula | C10H15FO5S |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | S-[[(5S,6S,6aS)-6-fluoro-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl] ethanethioate |
| SMILES | CC(=O)SC[C@H]1OC2OC(C)(C)O[C@@H]2[C@]1(O)F |
| InChI | InChI=1S/C10H15FO5S/c1-5(12)17-4-6-10(11,13)7-8(14-6)16-9(2,3)15-7/h6-8,13H,4H2,1-3H3/t6-,7+,8?,10+/m1/s1 |
| InChIKey | SPQKPASQVZGQLE-ABFRNEGJSA-N |
| XLogP | 0.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|