C11H18O6S — CID 6420383
S-[5-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] ethanethioate (PubChem CID 6420383) has the molecular formula C11H18O6S and a molecular weight of 278.33 g/mol. Its IUPAC name is S-[5-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] ethanethioate.
| Compound Name | S-[5-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] ethanethioate |
|---|---|
| PubChem CID | 6420383 |
| Molecular Formula | C11H18O6S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | S-[5-(1,2-dihydroxyethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] ethanethioate |
| SMILES | CC(=O)SC1C(C(O)CO)OC2OC(C)(C)OC21 |
| InChI | InChI=1S/C11H18O6S/c1-5(13)18-9-7(6(14)4-12)15-10-8(9)16-11(2,3)17-10/h6-10,12,14H,4H2,1-3H3 |
| InChIKey | DXAXOXHFDAYKIS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|