C12H20O5S — CID 10516607
S-[(1S)-1-[(3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl] ethanethioate (PubChem CID 10516607) has the molecular formula C12H20O5S and a molecular weight of 276.35 g/mol. Its IUPAC name is S-[(1S)-1-[(3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl] ethanethioate.
| Compound Name | S-[(1S)-1-[(3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl] ethanethioate |
|---|---|
| PubChem CID | 10516607 |
| Molecular Formula | C12H20O5S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | S-[(1S)-1-[(3aR,5S,6R,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl] ethanethioate |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H](C)SC(C)=O |
| InChI | InChI=1S/C12H20O5S/c1-6(18-7(2)13)8-9(14-5)10-11(15-8)17-12(3,4)16-10/h6,8-11H,1-5H3/t6-,8+,9-,10+,11+/m0/s1 |
| InChIKey | SKQCZIMFQZPMNO-WAWIWLGASA-N |
| XLogP | 1.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|