C8H14O4S — CID 537466
5-(hydroxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrothieno[2,3-d][1,3]dioxol-6-ol (PubChem CID 537466) has the molecular formula C8H14O4S and a molecular weight of 206.26 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrothieno[2,3-d][1,3]dioxol-6-ol.
| Compound Name | 5-(hydroxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrothieno[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 537466 |
| Molecular Formula | C8H14O4S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 5-(hydroxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrothieno[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)OC2SC(CO)C(O)C2O1 |
| InChI | InChI=1S/C8H14O4S/c1-8(2)11-6-5(10)4(3-9)13-7(6)12-8/h4-7,9-10H,3H2,1-2H3 |
| InChIKey | WMPMPQMLGDADLW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |