C10H15FO7S — CID 90793415
[(2R)-2-acetylsulfanyl-2-[(2S,3S,4S)-3-fluoro-3,4,5-trihydroxyoxolan-2-yl]ethyl] acetate (PubChem CID 90793415) has the molecular formula C10H15FO7S and a molecular weight of 298.29 g/mol. Its IUPAC name is [(2R)-2-acetylsulfanyl-2-[(2S,3S,4S)-3-fluoro-3,4,5-trihydroxyoxolan-2-yl]ethyl] acetate.
| Compound Name | [(2R)-2-acetylsulfanyl-2-[(2S,3S,4S)-3-fluoro-3,4,5-trihydroxyoxolan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 90793415 |
| Molecular Formula | C10H15FO7S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | [(2R)-2-acetylsulfanyl-2-[(2S,3S,4S)-3-fluoro-3,4,5-trihydroxyoxolan-2-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@@H](SC(C)=O)[C@H]1OC(O)[C@H](O)[C@]1(O)F |
| InChI | InChI=1S/C10H15FO7S/c1-4(12)17-3-6(19-5(2)13)8-10(11,16)7(14)9(15)18-8/h6-9,14-16H,3H2,1-2H3/t6-,7+,8-,9?,10-/m1/s1 |
| InChIKey | APMVYVBDUALCJL-ROTXYRCQSA-N |
| XLogP | -1.07 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|