C27H35N3O5 — CID 110069773
2-[11-[(4-morpholin-4-ylphenyl)methyl]-9-oxo-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl]acetic acid (PubChem CID 110069773) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is 2-[11-[(4-morpholin-4-ylphenyl)methyl]-9-oxo-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl]acetic acid.
| Compound Name | 2-[11-[(4-morpholin-4-ylphenyl)methyl]-9-oxo-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl]acetic acid |
|---|---|
| PubChem CID | 110069773 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 2-[11-[(4-morpholin-4-ylphenyl)methyl]-9-oxo-2-oxa-8,11-diazabicyclo[11.4.0]heptadeca-1(13),14,16-trien-15-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc2c(c1)CN(Cc1ccc(N3CCOCC3)cc1)CC(=O)NCCCCCO2 |
| InChI | InChI=1S/C27H35N3O5/c31-26-20-29(18-21-4-7-24(8-5-21)30-11-14-34-15-12-30)19-23-16-22(17-27(32)33)6-9-25(23)35-13-3-1-2-10-28-26/h4-9,16H,1-3,10-15,17-20H2,(H,28,31)(H,32,33) |
| InChIKey | ITBRGJMECJWFQB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|