C21H33NO4 — CID 110070083
1-[(4R,5S)-4,5-dihydroxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-trien-8-yl]-3,3-dimethylbutan-1-one (PubChem CID 110070083) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-[(4R,5S)-4,5-dihydroxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-trien-8-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[(4R,5S)-4,5-dihydroxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-trien-8-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 110070083 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 1-[(4R,5S)-4,5-dihydroxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-trien-8-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCCCc2ccccc2OC[C@@H](O)[C@@H](O)CC1 |
| InChI | InChI=1S/C21H33NO4/c1-21(2,3)14-20(25)22-12-7-6-9-16-8-4-5-10-19(16)26-15-18(24)17(23)11-13-22/h4-5,8,10,17-18,23-24H,6-7,9,11-15H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | BOOIRIPVMSSPTD-ZWKOTPCHSA-N |
| XLogP | 2.78 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |