C20H31NO6 — CID 155998346
1-[(4R,5R,6S)-4,5-dihydroxy-6-methoxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-trien-8-yl]-2-ethoxyethanone (PubChem CID 155998346) has the molecular formula C20H31NO6 and a molecular weight of 381.47 g/mol. Its IUPAC name is 1-[(4R,5R,6S)-4,5-dihydroxy-6-methoxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-trien-8-yl]-2-ethoxyethanone.
| Compound Name | 1-[(4R,5R,6S)-4,5-dihydroxy-6-methoxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-trien-8-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 155998346 |
| Molecular Formula | C20H31NO6 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-[(4R,5R,6S)-4,5-dihydroxy-6-methoxy-2-oxa-8-azabicyclo[11.4.0]heptadeca-1(17),13,15-trien-8-yl]-2-ethoxyethanone |
| SMILES | CCOCC(=O)N1CCCCc2ccccc2OC[C@@H](O)[C@@H](O)[C@@H](OC)C1 |
| InChI | InChI=1S/C20H31NO6/c1-3-26-14-19(23)21-11-7-6-9-15-8-4-5-10-17(15)27-13-16(22)20(24)18(12-21)25-2/h4-5,8,10,16,18,20,22,24H,3,6-7,9,11-14H2,1-2H3/t16-,18+,20-/m1/s1 |
| InChIKey | LPTPJTCMHGOXIV-IMFGXOCKSA-N |
| XLogP | 1.00 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |